C12H16N2O3S — CID 51106392
ethyl 2-[2-(pent-4-enoylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 51106392) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is ethyl 2-[2-(pent-4-enoylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(pent-4-enoylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 51106392 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | ethyl 2-[2-(pent-4-enoylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | C=CCCC(=O)Nc1nc(CC(=O)OCC)cs1 |
| InChI | InChI=1S/C12H16N2O3S/c1-3-5-6-10(15)14-12-13-9(8-18-12)7-11(16)17-4-2/h3,8H,1,4-7H2,2H3,(H,13,14,15) |
| InChIKey | KXEZFQKNIFQDRE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|