C16H17ClN2O3S — CID 19220870
ethyl 2-[2-[3-(4-chlorophenyl)propanoylamino]-1,3-thiazol-4-yl]acetate (PubChem CID 19220870) has the molecular formula C16H17ClN2O3S and a molecular weight of 352.84 g/mol. Its IUPAC name is ethyl 2-[2-[3-(4-chlorophenyl)propanoylamino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[3-(4-chlorophenyl)propanoylamino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 19220870 |
| Molecular Formula | C16H17ClN2O3S |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | ethyl 2-[2-[3-(4-chlorophenyl)propanoylamino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)CCc2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H17ClN2O3S/c1-2-22-15(21)9-13-10-23-16(18-13)19-14(20)8-5-11-3-6-12(17)7-4-11/h3-4,6-7,10H,2,5,8-9H2,1H3,(H,18,19,20) |
| InChIKey | NUBLJJCTKFGNKY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |