C8H11N3O2S2 — CID 16637409
ethyl 2-[2-(carbamothioylamino)-1,3-thiazol-4-yl]acetate (PubChem CID 16637409) has the molecular formula C8H11N3O2S2 and a molecular weight of 245.33 g/mol. Its IUPAC name is ethyl 2-[2-(carbamothioylamino)-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(carbamothioylamino)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16637409 |
| Molecular Formula | C8H11N3O2S2 |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | ethyl 2-[2-(carbamothioylamino)-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(N)=S)n1 |
| InChI | InChI=1S/C8H11N3O2S2/c1-2-13-6(12)3-5-4-15-8(10-5)11-7(9)14/h4H,2-3H2,1H3,(H3,9,10,11,14) |
| InChIKey | URONEHYOXSPUDU-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|