C12H14Br2N2O3S — CID 4098348
ethyl 2-[2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 4098348) has the molecular formula C12H14Br2N2O3S and a molecular weight of 426.13 g/mol. Its IUPAC name is ethyl 2-[2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 4098348 |
| Molecular Formula | C12H14Br2N2O3S |
| Molecular Weight | 426.13 g/mol |
| Exact Mass | 423.91 |
| IUPAC Name | ethyl 2-[2-[(2,2-dibromo-1-methylcyclopropanecarbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C2(C)CC2(Br)Br)n1 |
| InChI | InChI=1S/C12H14Br2N2O3S/c1-3-19-8(17)4-7-5-20-10(15-7)16-9(18)11(2)6-12(11,13)14/h5H,3-4,6H2,1-2H3,(H,15,16,18) |
| InChIKey | JRVAFYWVSBUKBD-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.13 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|