C18H23ClN2O3S — CID 3261049
ethyl 2-[2-[(3-chloroadamantane-1-carbonyl)amino]-1,3-thiazol-4-yl]acetate (PubChem CID 3261049) has the molecular formula C18H23ClN2O3S and a molecular weight of 382.91 g/mol. Its IUPAC name is ethyl 2-[2-[(3-chloroadamantane-1-carbonyl)amino]-1,3-thiazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-[(3-chloroadamantane-1-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 3261049 |
| Molecular Formula | C18H23ClN2O3S |
| Molecular Weight | 382.91 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | ethyl 2-[2-[(3-chloroadamantane-1-carbonyl)amino]-1,3-thiazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1csc(NC(=O)C23CC4CC(CC(Cl)(C4)C2)C3)n1 |
| InChI | InChI=1S/C18H23ClN2O3S/c1-2-24-14(22)4-13-9-25-16(20-13)21-15(23)17-5-11-3-12(6-17)8-18(19,7-11)10-17/h9,11-12H,2-8,10H2,1H3,(H,20,21,23) |
| InChIKey | WXKJULQQUVKFGR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|