C21H23ClN2O2S — CID 7948017
(5S,7R)-3-chloro-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide (PubChem CID 7948017) has the molecular formula C21H23ClN2O2S and a molecular weight of 402.95 g/mol. Its IUPAC name is (5S,7R)-3-chloro-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide.
| Compound Name | (5S,7R)-3-chloro-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 7948017 |
| Molecular Formula | C21H23ClN2O2S |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | (5S,7R)-3-chloro-N-[4-(4-methoxyphenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
| SMILES | COc1ccc(-c2csc(NC(=O)C34C[C@@H]5C[C@@H](CC(Cl)(C5)C3)C4)n2)cc1 |
| InChI | InChI=1S/C21H23ClN2O2S/c1-26-16-4-2-15(3-5-16)17-11-27-19(23-17)24-18(25)20-7-13-6-14(8-20)10-21(22,9-13)12-20/h2-5,11,13-14H,6-10,12H2,1H3,(H,23,24,25)/t13-,14+,20?,21? |
| InChIKey | RGSSWHZJMALFHL-ZXPDZVFASA-N |
| XLogP | 5.34 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|