C20H19ClF2N2OS — CID 98277662
(5R,7R)-3-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide (PubChem CID 98277662) has the molecular formula C20H19ClF2N2OS and a molecular weight of 408.90 g/mol. Its IUPAC name is (5R,7R)-3-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide.
| Compound Name | (5R,7R)-3-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 98277662 |
| Molecular Formula | C20H19ClF2N2OS |
| Molecular Weight | 408.90 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | (5R,7R)-3-chloro-N-[4-(3,4-difluorophenyl)-1,3-thiazol-2-yl]adamantane-1-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2)cs1)C12C[C@H]3C[C@@H](CC(Cl)(C3)C1)C2 |
| InChI | InChI=1S/C20H19ClF2N2OS/c21-20-7-11-3-12(8-20)6-19(5-11,10-20)17(26)25-18-24-16(9-27-18)13-1-2-14(22)15(23)4-13/h1-2,4,9,11-12H,3,5-8,10H2,(H,24,25,26)/t11-,12-,19?,20?/m1/s1 |
| InChIKey | PJDINQIMBNFNPC-MUUFFUEKSA-N |
| XLogP | 5.60 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.90 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|