C22H27N3OS — CID 5034381
N-[4-[2-(ethylamino)-1,3-thiazol-4-yl]phenyl]adamantane-1-carboxamide (PubChem CID 5034381) has the molecular formula C22H27N3OS and a molecular weight of 381.55 g/mol. Its IUPAC name is N-[4-[2-(ethylamino)-1,3-thiazol-4-yl]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[2-(ethylamino)-1,3-thiazol-4-yl]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 5034381 |
| Molecular Formula | C22H27N3OS |
| Molecular Weight | 381.55 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[4-[2-(ethylamino)-1,3-thiazol-4-yl]phenyl]adamantane-1-carboxamide |
| SMILES | CCNc1nc(-c2ccc(NC(=O)C34CC5CC(CC(C5)C3)C4)cc2)cs1 |
| InChI | InChI=1S/C22H27N3OS/c1-2-23-21-25-19(13-27-21)17-3-5-18(6-4-17)24-20(26)22-10-14-7-15(11-22)9-16(8-14)12-22/h3-6,13-16H,2,7-12H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | NYIVLASSXRLVNO-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.55 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |