C20H29NOSi — CID 171577278
N-(4-trimethylsilylphenyl)adamantane-1-carboxamide (PubChem CID 171577278) has the molecular formula C20H29NOSi and a molecular weight of 327.54 g/mol. Its IUPAC name is N-(4-trimethylsilylphenyl)adamantane-1-carboxamide.
| Compound Name | N-(4-trimethylsilylphenyl)adamantane-1-carboxamide |
|---|---|
| PubChem CID | 171577278 |
| Molecular Formula | C20H29NOSi |
| Molecular Weight | 327.54 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-(4-trimethylsilylphenyl)adamantane-1-carboxamide |
| SMILES | C[Si](C)(C)c1ccc(NC(=O)C23CC4CC(CC(C4)C2)C3)cc1 |
| InChI | InChI=1S/C20H29NOSi/c1-23(2,3)18-6-4-17(5-7-18)21-19(22)20-11-14-8-15(12-20)10-16(9-14)13-20/h4-7,14-16H,8-13H2,1-3H3,(H,21,22) |
| InChIKey | NRMTVOLKEGSNCP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.54 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|