C29H33N5O — CID 122297677
N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide (PubChem CID 122297677) has the molecular formula C29H33N5O and a molecular weight of 467.62 g/mol. Its IUPAC name is N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide.
| Compound Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide |
|---|---|
| PubChem CID | 122297677 |
| Molecular Formula | C29H33N5O |
| Molecular Weight | 467.62 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]adamantane-1-carboxamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)C45CC6CC(CC(C6)C4)C5)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C29H33N5O/c1-18-3-5-23(6-4-18)32-26-14-27(31-19(2)30-26)33-24-7-9-25(10-8-24)34-28(35)29-15-20-11-21(16-29)13-22(12-20)17-29/h3-10,14,20-22H,11-13,15-17H2,1-2H3,(H,34,35)(H2,30,31,32,33) |
| InChIKey | SAXJDGKFRCDRSE-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.62 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |