C26H25N5O — CID 50748504
N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylacetamide (PubChem CID 50748504) has the molecular formula C26H25N5O and a molecular weight of 423.52 g/mol. Its IUPAC name is N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylacetamide.
| Compound Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylacetamide |
|---|---|
| PubChem CID | 50748504 |
| Molecular Formula | C26H25N5O |
| Molecular Weight | 423.52 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylacetamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)Cc4ccccc4)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C26H25N5O/c1-18-8-10-21(11-9-18)29-24-17-25(28-19(2)27-24)30-22-12-14-23(15-13-22)31-26(32)16-20-6-4-3-5-7-20/h3-15,17H,16H2,1-2H3,(H,31,32)(H2,27,28,29,30) |
| InChIKey | HURPBISPHWJYRO-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.52 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |