C27H27N5O2 — CID 122297755
N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylmethoxyacetamide (PubChem CID 122297755) has the molecular formula C27H27N5O2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylmethoxyacetamide.
| Compound Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylmethoxyacetamide |
|---|---|
| PubChem CID | 122297755 |
| Molecular Formula | C27H27N5O2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.22 |
| IUPAC Name | N-[4-[[2-methyl-6-(4-methylanilino)pyrimidin-4-yl]amino]phenyl]-2-phenylmethoxyacetamide |
| SMILES | Cc1ccc(Nc2cc(Nc3ccc(NC(=O)COCc4ccccc4)cc3)nc(C)n2)cc1 |
| InChI | InChI=1S/C27H27N5O2/c1-19-8-10-22(11-9-19)30-25-16-26(29-20(2)28-25)31-23-12-14-24(15-13-23)32-27(33)18-34-17-21-6-4-3-5-7-21/h3-16H,17-18H2,1-2H3,(H,32,33)(H2,28,29,30,31) |
| InChIKey | BBLZNCJHBQTMTO-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 88.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |