C24H22N6O2 — CID 122316019
2-phenylmethoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122316019) has the molecular formula C24H22N6O2 and a molecular weight of 426.48 g/mol. Its IUPAC name is 2-phenylmethoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-phenylmethoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122316019 |
| Molecular Formula | C24H22N6O2 |
| Molecular Weight | 426.48 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-phenylmethoxy-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | O=C(COCc1ccccc1)Nc1ccc(Nc2cc(Nc3ccccn3)ncn2)cc1 |
| InChI | InChI=1S/C24H22N6O2/c31-24(16-32-15-18-6-2-1-3-7-18)29-20-11-9-19(10-12-20)28-22-14-23(27-17-26-22)30-21-8-4-5-13-25-21/h1-14,17H,15-16H2,(H,29,31)(H2,25,26,27,28,30) |
| InChIKey | WGFBJLNQUSVMLK-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 101.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.48 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |