C23H19FN6O — CID 122315816
2-(4-fluorophenyl)-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122315816) has the molecular formula C23H19FN6O and a molecular weight of 414.44 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-(4-fluorophenyl)-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122315816 |
| Molecular Formula | C23H19FN6O |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 2-(4-fluorophenyl)-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | O=C(Cc1ccc(F)cc1)Nc1ccc(Nc2cc(Nc3ccccn3)ncn2)cc1 |
| InChI | InChI=1S/C23H19FN6O/c24-17-6-4-16(5-7-17)13-23(31)29-19-10-8-18(9-11-19)28-21-14-22(27-15-26-21)30-20-3-1-2-12-25-20/h1-12,14-15H,13H2,(H,29,31)(H2,25,26,27,28,30) |
| InChIKey | LIUKWKZGPBVEOC-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 91.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |