C20H18N8O — CID 122316044
2-pyrazol-1-yl-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide (PubChem CID 122316044) has the molecular formula C20H18N8O and a molecular weight of 386.42 g/mol. Its IUPAC name is 2-pyrazol-1-yl-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide.
| Compound Name | 2-pyrazol-1-yl-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 122316044 |
| Molecular Formula | C20H18N8O |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 2-pyrazol-1-yl-N-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]acetamide |
| SMILES | O=C(Cn1cccn1)Nc1ccc(Nc2cc(Nc3ccccn3)ncn2)cc1 |
| InChI | InChI=1S/C20H18N8O/c29-20(13-28-11-3-10-24-28)26-16-7-5-15(6-8-16)25-18-12-19(23-14-22-18)27-17-4-1-2-9-21-17/h1-12,14H,13H2,(H,26,29)(H2,21,22,23,25,27) |
| InChIKey | GCKPCBOJUIKHES-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 109.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |