C26H27N7O — CID 122316135
1-(4-tert-butylphenyl)-3-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea (PubChem CID 122316135) has the molecular formula C26H27N7O and a molecular weight of 453.55 g/mol. Its IUPAC name is 1-(4-tert-butylphenyl)-3-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea.
| Compound Name | 1-(4-tert-butylphenyl)-3-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea |
|---|---|
| PubChem CID | 122316135 |
| Molecular Formula | C26H27N7O |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.23 |
| IUPAC Name | 1-(4-tert-butylphenyl)-3-[4-[[6-(pyridin-2-ylamino)pyrimidin-4-yl]amino]phenyl]urea |
| SMILES | CC(C)(C)c1ccc(NC(=O)Nc2ccc(Nc3cc(Nc4ccccn4)ncn3)cc2)cc1 |
| InChI | InChI=1S/C26H27N7O/c1-26(2,3)18-7-9-20(10-8-18)31-25(34)32-21-13-11-19(12-14-21)30-23-16-24(29-17-28-23)33-22-6-4-5-15-27-22/h4-17H,1-3H3,(H2,31,32,34)(H2,27,28,29,30,33) |
| InChIKey | GQSHCXGSKDLQFR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |