C17H19N3O2 — CID 108525928
N-(4-tert-butylphenyl)-N'-pyridin-2-yloxamide (PubChem CID 108525928) has the molecular formula C17H19N3O2 and a molecular weight of 297.36 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N'-pyridin-2-yloxamide.
| Compound Name | N-(4-tert-butylphenyl)-N'-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 108525928 |
| Molecular Formula | C17H19N3O2 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | N-(4-tert-butylphenyl)-N'-pyridin-2-yloxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)C(=O)Nc2ccccn2)cc1 |
| InChI | InChI=1S/C17H19N3O2/c1-17(2,3)12-7-9-13(10-8-12)19-15(21)16(22)20-14-6-4-5-11-18-14/h4-11H,1-3H3,(H,19,21)(H,18,20,22) |
| InChIKey | JKYUUMIRGKMACD-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|