C14H9ClF3N3O2 — CID 108515817
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-pyridin-2-yloxamide (PubChem CID 108515817) has the molecular formula C14H9ClF3N3O2 and a molecular weight of 343.69 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-pyridin-2-yloxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-pyridin-2-yloxamide |
|---|---|
| PubChem CID | 108515817 |
| Molecular Formula | C14H9ClF3N3O2 |
| Molecular Weight | 343.69 g/mol |
| Exact Mass | 343.03 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-pyridin-2-yloxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)Nc1ccccn1 |
| InChI | InChI=1S/C14H9ClF3N3O2/c15-10-5-4-8(7-9(10)14(16,17)18)20-12(22)13(23)21-11-3-1-2-6-19-11/h1-7H,(H,20,22)(H,19,21,23) |
| InChIKey | QEDSMEHYVKPTBZ-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.69 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|