C15H13ClF3N3O — CID 108999180
N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(pyridin-2-ylmethylamino)acetamide (PubChem CID 108999180) has the molecular formula C15H13ClF3N3O and a molecular weight of 343.74 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(pyridin-2-ylmethylamino)acetamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(pyridin-2-ylmethylamino)acetamide |
|---|---|
| PubChem CID | 108999180 |
| Molecular Formula | C15H13ClF3N3O |
| Molecular Weight | 343.74 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2-(pyridin-2-ylmethylamino)acetamide |
| SMILES | O=C(CNCc1ccccn1)Nc1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H13ClF3N3O/c16-13-5-4-10(7-12(13)15(17,18)19)22-14(23)9-20-8-11-3-1-2-6-21-11/h1-7,20H,8-9H2,(H,22,23) |
| InChIKey | PJXKWWFVNNHKFB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.74 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |