C16H10ClF3N4O2 — CID 108515847
N'-(3H-benzimidazol-5-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide (PubChem CID 108515847) has the molecular formula C16H10ClF3N4O2 and a molecular weight of 382.73 g/mol. Its IUPAC name is N'-(3H-benzimidazol-5-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide.
| Compound Name | N'-(3H-benzimidazol-5-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
|---|---|
| PubChem CID | 108515847 |
| Molecular Formula | C16H10ClF3N4O2 |
| Molecular Weight | 382.73 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N'-(3H-benzimidazol-5-yl)-N-[4-chloro-3-(trifluoromethyl)phenyl]oxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)C(=O)Nc1ccc2nc[nH]c2c1 |
| InChI | InChI=1S/C16H10ClF3N4O2/c17-11-3-1-8(5-10(11)16(18,19)20)23-14(25)15(26)24-9-2-4-12-13(6-9)22-7-21-12/h1-7H,(H,21,22)(H,23,25)(H,24,26) |
| InChIKey | XWAJTUQYTBFYGV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.73 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|