C16H12ClF3N2O3 — CID 108515794
N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2-hydroxy-5-methylphenyl)oxamide (PubChem CID 108515794) has the molecular formula C16H12ClF3N2O3 and a molecular weight of 372.73 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2-hydroxy-5-methylphenyl)oxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2-hydroxy-5-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108515794 |
| Molecular Formula | C16H12ClF3N2O3 |
| Molecular Weight | 372.73 g/mol |
| Exact Mass | 372.05 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-N'-(2-hydroxy-5-methylphenyl)oxamide |
| SMILES | Cc1ccc(O)c(NC(=O)C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C16H12ClF3N2O3/c1-8-2-5-13(23)12(6-8)22-15(25)14(24)21-9-3-4-11(17)10(7-9)16(18,19)20/h2-7,23H,1H3,(H,21,24)(H,22,25) |
| InChIKey | MEAKXIGSFHDZND-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.73 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|