C17H15ClF3NO — CID 17168215
N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4,6-trimethylbenzamide (PubChem CID 17168215) has the molecular formula C17H15ClF3NO and a molecular weight of 341.76 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4,6-trimethylbenzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4,6-trimethylbenzamide |
|---|---|
| PubChem CID | 17168215 |
| Molecular Formula | C17H15ClF3NO |
| Molecular Weight | 341.76 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-2,4,6-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)Nc2ccc(Cl)c(C(F)(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C17H15ClF3NO/c1-9-6-10(2)15(11(3)7-9)16(23)22-12-4-5-14(18)13(8-12)17(19,20)21/h4-8H,1-3H3,(H,22,23) |
| InChIKey | SDCVPAWVFJRQMZ-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.76 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |