C14H7Cl2F4NO — CID 17168217
2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-fluorobenzamide (PubChem CID 17168217) has the molecular formula C14H7Cl2F4NO and a molecular weight of 352.11 g/mol. Its IUPAC name is 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-fluorobenzamide.
| Compound Name | 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 17168217 |
| Molecular Formula | C14H7Cl2F4NO |
| Molecular Weight | 352.11 g/mol |
| Exact Mass | 350.98 |
| IUPAC Name | 2-chloro-N-[4-chloro-3-(trifluoromethyl)phenyl]-4-fluorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc(F)cc1Cl |
| InChI | InChI=1S/C14H7Cl2F4NO/c15-11-4-2-8(6-10(11)14(18,19)20)21-13(22)9-3-1-7(17)5-12(9)16/h1-6H,(H,21,22) |
| InChIKey | DNNHFOVTSJPASV-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.11 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |