C14H7ClF5NO — CID 2084506
N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-difluorobenzamide (PubChem CID 2084506) has the molecular formula C14H7ClF5NO and a molecular weight of 335.66 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-difluorobenzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-difluorobenzamide |
|---|---|
| PubChem CID | 2084506 |
| Molecular Formula | C14H7ClF5NO |
| Molecular Weight | 335.66 g/mol |
| Exact Mass | 335.01 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-3,5-difluorobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cc(F)cc(F)c1 |
| InChI | InChI=1S/C14H7ClF5NO/c15-12-2-1-10(6-11(12)14(18,19)20)21-13(22)7-3-8(16)5-9(17)4-7/h1-6H,(H,21,22) |
| InChIKey | DHKHHYHZCMFCLM-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.66 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |