C14H8ClF3INO — CID 1221652
N-[4-chloro-3-(trifluoromethyl)phenyl]-4-iodobenzamide (PubChem CID 1221652) has the molecular formula C14H8ClF3INO and a molecular weight of 425.58 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-4-iodobenzamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-iodobenzamide |
|---|---|
| PubChem CID | 1221652 |
| Molecular Formula | C14H8ClF3INO |
| Molecular Weight | 425.58 g/mol |
| Exact Mass | 424.93 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-4-iodobenzamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H8ClF3INO/c15-12-6-5-10(7-11(12)14(16,17)18)20-13(21)8-1-3-9(19)4-2-8/h1-7H,(H,20,21) |
| InChIKey | CSGZGROUTXMWHP-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.58 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|