C14H8Cl2F3NO — CID 154268338
4-chloro-N-(3-chlorophenyl)-3-(trifluoromethyl)benzamide (PubChem CID 154268338) has the molecular formula C14H8Cl2F3NO and a molecular weight of 334.12 g/mol. Its IUPAC name is 4-chloro-N-(3-chlorophenyl)-3-(trifluoromethyl)benzamide.
| Compound Name | 4-chloro-N-(3-chlorophenyl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 154268338 |
| Molecular Formula | C14H8Cl2F3NO |
| Molecular Weight | 334.12 g/mol |
| Exact Mass | 332.99 |
| IUPAC Name | 4-chloro-N-(3-chlorophenyl)-3-(trifluoromethyl)benzamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1ccc(Cl)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H8Cl2F3NO/c15-9-2-1-3-10(7-9)20-13(21)8-4-5-12(16)11(6-8)14(17,18)19/h1-7H,(H,20,21) |
| InChIKey | XYKJCECYTMWDRI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.12 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |