C22H13ClF3N3O2 — CID 144862877
5-[2-[3-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]phenyl]ethynyl]pyridine-3-carboxamide (PubChem CID 144862877) has the molecular formula C22H13ClF3N3O2 and a molecular weight of 443.81 g/mol. Its IUPAC name is 5-[2-[3-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]phenyl]ethynyl]pyridine-3-carboxamide.
| Compound Name | 5-[2-[3-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]phenyl]ethynyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 144862877 |
| Molecular Formula | C22H13ClF3N3O2 |
| Molecular Weight | 443.81 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | 5-[2-[3-[[4-chloro-3-(trifluoromethyl)benzoyl]amino]phenyl]ethynyl]pyridine-3-carboxamide |
| SMILES | NC(=O)c1cncc(C#Cc2cccc(NC(=O)c3ccc(Cl)c(C(F)(F)F)c3)c2)c1 |
| InChI | InChI=1S/C22H13ClF3N3O2/c23-19-7-6-15(10-18(19)22(24,25)26)21(31)29-17-3-1-2-13(9-17)4-5-14-8-16(20(27)30)12-28-11-14/h1-3,6-12H,(H2,27,30)(H,29,31) |
| InChIKey | HWYLRGNCYWXJJS-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.81 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|