C18H17ClF3N3O — CID 109226611
N-[4-chloro-3-(trifluoromethyl)phenyl]-5-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 109226611) has the molecular formula C18H17ClF3N3O and a molecular weight of 383.80 g/mol. Its IUPAC name is N-[4-chloro-3-(trifluoromethyl)phenyl]-5-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226611 |
| Molecular Formula | C18H17ClF3N3O |
| Molecular Weight | 383.80 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[4-chloro-3-(trifluoromethyl)phenyl]-5-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)c(C(F)(F)F)c1)c1cncc(N2CCCCC2)c1 |
| InChI | InChI=1S/C18H17ClF3N3O/c19-16-5-4-13(9-15(16)18(20,21)22)24-17(26)12-8-14(11-23-10-12)25-6-2-1-3-7-25/h4-5,8-11H,1-3,6-7H2,(H,24,26) |
| InChIKey | XZQQNZAMSPFSLF-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.80 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |