C17H18ClN3O — CID 109226552
N-(3-chlorophenyl)-5-piperidin-1-ylpyridine-3-carboxamide (PubChem CID 109226552) has the molecular formula C17H18ClN3O and a molecular weight of 315.80 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-piperidin-1-ylpyridine-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-piperidin-1-ylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109226552 |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.80 g/mol |
| Exact Mass | 315.11 |
| IUPAC Name | N-(3-chlorophenyl)-5-piperidin-1-ylpyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cncc(N2CCCCC2)c1 |
| InChI | InChI=1S/C17H18ClN3O/c18-14-5-4-6-15(10-14)20-17(22)13-9-16(12-19-11-13)21-7-2-1-3-8-21/h4-6,9-12H,1-3,7-8H2,(H,20,22) |
| InChIKey | MDGPEWMKEONRFD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.80 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |