C21H20ClN5O — CID 109268738
N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-5-carboxamide (PubChem CID 109268738) has the molecular formula C21H20ClN5O and a molecular weight of 393.88 g/mol. Its IUPAC name is N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 109268738 |
| Molecular Formula | C21H20ClN5O |
| Molecular Weight | 393.88 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | N-(3-chlorophenyl)-2-(4-pyrrolidin-1-ylanilino)pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cnc(Nc2ccc(N3CCCC3)cc2)nc1 |
| InChI | InChI=1S/C21H20ClN5O/c22-16-4-3-5-18(12-16)25-20(28)15-13-23-21(24-14-15)26-17-6-8-19(9-7-17)27-10-1-2-11-27/h3-9,12-14H,1-2,10-11H2,(H,25,28)(H,23,24,26) |
| InChIKey | TTYBZSCBIOBHBQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.88 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|