C22H21ClN4O — CID 109244496
N-(3-chlorophenyl)-5-(4-pyrrolidin-1-ylanilino)pyridine-3-carboxamide (PubChem CID 109244496) has the molecular formula C22H21ClN4O and a molecular weight of 392.89 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-(4-pyrrolidin-1-ylanilino)pyridine-3-carboxamide.
| Compound Name | N-(3-chlorophenyl)-5-(4-pyrrolidin-1-ylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109244496 |
| Molecular Formula | C22H21ClN4O |
| Molecular Weight | 392.89 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(3-chlorophenyl)-5-(4-pyrrolidin-1-ylanilino)pyridine-3-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)c1cncc(Nc2ccc(N3CCCC3)cc2)c1 |
| InChI | InChI=1S/C22H21ClN4O/c23-17-4-3-5-19(13-17)26-22(28)16-12-20(15-24-14-16)25-18-6-8-21(9-7-18)27-10-1-2-11-27/h3-9,12-15,25H,1-2,10-11H2,(H,26,28) |
| InChIKey | YOHIKSFCZPAIHI-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 57.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.89 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|