C20H13ClN2O — CID 2822311
N-(4-chlorophenyl)-5-(2-phenylethynyl)pyridine-3-carboxamide (PubChem CID 2822311) has the molecular formula C20H13ClN2O and a molecular weight of 332.79 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(2-phenylethynyl)pyridine-3-carboxamide.
| Compound Name | N-(4-chlorophenyl)-5-(2-phenylethynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 2822311 |
| Molecular Formula | C20H13ClN2O |
| Molecular Weight | 332.79 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | N-(4-chlorophenyl)-5-(2-phenylethynyl)pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cncc(C#Cc2ccccc2)c1 |
| InChI | InChI=1S/C20H13ClN2O/c21-18-8-10-19(11-9-18)23-20(24)17-12-16(13-22-14-17)7-6-15-4-2-1-3-5-15/h1-5,8-14H,(H,23,24) |
| InChIKey | XYHVENHARHKKDE-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.79 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|