C26H26N4O — CID 58866923
N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-(2-phenylethynyl)pyridine-3-carboxamide (PubChem CID 58866923) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-(2-phenylethynyl)pyridine-3-carboxamide.
| Compound Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-(2-phenylethynyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 58866923 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-5-(2-phenylethynyl)pyridine-3-carboxamide |
| SMILES | CN(C)C1CCN(c2ccc(NC(=O)c3cncc(C#Cc4ccccc4)c3)cc2)C1 |
| InChI | InChI=1S/C26H26N4O/c1-29(2)25-14-15-30(19-25)24-12-10-23(11-13-24)28-26(31)22-16-21(17-27-18-22)9-8-20-6-4-3-5-7-20/h3-7,10-13,16-18,25H,14-15,19H2,1-2H3,(H,28,31) |
| InChIKey | DVKMFVZHQVDZTC-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 48.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|