C30H34N4O — CID 58866413
1-benzyl-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 58866413) has the molecular formula C30H34N4O and a molecular weight of 466.63 g/mol. Its IUPAC name is 1-benzyl-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-benzyl-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 58866413 |
| Molecular Formula | C30H34N4O |
| Molecular Weight | 466.63 g/mol |
| Exact Mass | 466.27 |
| IUPAC Name | 1-benzyl-N-[4-[3-(dimethylamino)pyrrolidin-1-yl]phenyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)Nc3ccc(N4CCC(N(C)C)C4)cc3)cc12 |
| InChI | InChI=1S/C30H34N4O/c1-21-22(2)34(19-23-8-6-5-7-9-23)29-15-10-24(18-28(21)29)30(35)31-25-11-13-26(14-12-25)33-17-16-27(20-33)32(3)4/h5-15,18,27H,16-17,19-20H2,1-4H3,(H,31,35) |
| InChIKey | IWUBFHUFDJVULT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 40.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.63 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|