C23H28N2O — CID 20940136
1-benzyl-2,3-dimethyl-N-(3-methylbutyl)indole-5-carboxamide (PubChem CID 20940136) has the molecular formula C23H28N2O and a molecular weight of 348.49 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethyl-N-(3-methylbutyl)indole-5-carboxamide.
| Compound Name | 1-benzyl-2,3-dimethyl-N-(3-methylbutyl)indole-5-carboxamide |
|---|---|
| PubChem CID | 20940136 |
| Molecular Formula | C23H28N2O |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | 1-benzyl-2,3-dimethyl-N-(3-methylbutyl)indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)NCCC(C)C)cc12 |
| InChI | InChI=1S/C23H28N2O/c1-16(2)12-13-24-23(26)20-10-11-22-21(14-20)17(3)18(4)25(22)15-19-8-6-5-7-9-19/h5-11,14,16H,12-13,15H2,1-4H3,(H,24,26) |
| InChIKey | LIIFIJAIEIFNEU-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|