C24H26N4O — CID 29096679
1-benzyl-2,3-dimethyl-N-[(2R)-1-pyrazol-1-ylpropan-2-yl]indole-5-carboxamide (PubChem CID 29096679) has the molecular formula C24H26N4O and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethyl-N-[(2R)-1-pyrazol-1-ylpropan-2-yl]indole-5-carboxamide.
| Compound Name | 1-benzyl-2,3-dimethyl-N-[(2R)-1-pyrazol-1-ylpropan-2-yl]indole-5-carboxamide |
|---|---|
| PubChem CID | 29096679 |
| Molecular Formula | C24H26N4O |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 1-benzyl-2,3-dimethyl-N-[(2R)-1-pyrazol-1-ylpropan-2-yl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ccc(C(=O)N[C@H](C)Cn3cccn3)cc12 |
| InChI | InChI=1S/C24H26N4O/c1-17(15-27-13-7-12-25-27)26-24(29)21-10-11-23-22(14-21)18(2)19(3)28(23)16-20-8-5-4-6-9-20/h4-14,17H,15-16H2,1-3H3,(H,26,29)/t17-/m1/s1 |
| InChIKey | PNLYQTHEANRGOF-QGZVFWFLSA-N |
| XLogP | 4.32 |
| TPSA | 51.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|