C33H31ClN2O — CID 71099318
N-[(1S)-1-(4-chloro-2-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 71099318) has the molecular formula C33H31ClN2O and a molecular weight of 507.08 g/mol. Its IUPAC name is N-[(1S)-1-(4-chloro-2-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(4-chloro-2-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099318 |
| Molecular Formula | C33H31ClN2O |
| Molecular Weight | 507.08 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | N-[(1S)-1-(4-chloro-2-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1cc(Cl)ccc1[C@H](C)NC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H31ClN2O/c1-21-18-29(34)15-16-30(21)23(3)35-33(37)28-14-17-32-31(19-28)22(2)24(4)36(32)20-25-10-12-27(13-11-25)26-8-6-5-7-9-26/h5-19,23H,20H2,1-4H3,(H,35,37)/t23-/m0/s1 |
| InChIKey | SZTZVRYRNHQXIG-QHCPKHFHSA-N |
| XLogP | 8.43 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.08 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|