C33H28F4N2O — CID 71099331
N-[(1R)-1-[5-fluoro-2-(trifluoromethyl)phenyl]ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 71099331) has the molecular formula C33H28F4N2O and a molecular weight of 544.59 g/mol. Its IUPAC name is N-[(1R)-1-[5-fluoro-2-(trifluoromethyl)phenyl]ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(1R)-1-[5-fluoro-2-(trifluoromethyl)phenyl]ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099331 |
| Molecular Formula | C33H28F4N2O |
| Molecular Weight | 544.59 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | N-[(1R)-1-[5-fluoro-2-(trifluoromethyl)phenyl]ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@H](C)c3cc(F)ccc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C33H28F4N2O/c1-20-22(3)39(19-23-9-11-25(12-10-23)24-7-5-4-6-8-24)31-16-13-26(17-28(20)31)32(40)38-21(2)29-18-27(34)14-15-30(29)33(35,36)37/h4-18,21H,19H2,1-3H3,(H,38,40)/t21-/m1/s1 |
| InChIKey | OCZGQQDZIIRSSJ-OAQYLSRUSA-N |
| XLogP | 8.62 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.59 |
| LogP ≤ 5 | 8.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|