C34H28F4N2O3 — CID 53470376
2-[4-[[5-[[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 53470376) has the molecular formula C34H28F4N2O3 and a molecular weight of 588.60 g/mol. Its IUPAC name is 2-[4-[[5-[[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 53470376 |
| Molecular Formula | C34H28F4N2O3 |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 2-[4-[[5-[[(1S)-1-[2-fluoro-6-(trifluoromethyl)phenyl]ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3c(F)cccc3C(F)(F)F)cc12 |
| InChI | InChI=1S/C34H28F4N2O3/c1-19-21(3)40(18-22-11-13-23(14-12-22)25-7-4-5-8-26(25)33(42)43)30-16-15-24(17-27(19)30)32(41)39-20(2)31-28(34(36,37)38)9-6-10-29(31)35/h4-17,20H,18H2,1-3H3,(H,39,41)(H,42,43)/t20-/m0/s1 |
| InChIKey | NTTWXQWLQNIXSH-FQEVSTJZSA-N |
| XLogP | 8.32 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|