C33H28Cl2N2O3 — CID 71074888
2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074888) has the molecular formula C33H28Cl2N2O3 and a molecular weight of 571.50 g/mol. Its IUPAC name is 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074888 |
| Molecular Formula | C33H28Cl2N2O3 |
| Molecular Weight | 571.50 g/mol |
| Exact Mass | 570.15 |
| IUPAC Name | 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)NC(C)c3ccc(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C33H28Cl2N2O3/c1-19-21(3)37(18-22-8-10-23(11-9-22)27-6-4-5-7-28(27)33(39)40)31-15-12-24(16-29(19)31)32(38)36-20(2)26-14-13-25(34)17-30(26)35/h4-17,20H,18H2,1-3H3,(H,36,38)(H,39,40) |
| InChIKey | BUAUNSREZVSWFG-UHFFFAOYSA-N |
| XLogP | 8.47 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.50 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|