C34H29N3O3 — CID 71109475
2-[4-[[5-[[(1S)-1-(2-cyanophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71109475) has the molecular formula C34H29N3O3 and a molecular weight of 527.62 g/mol. Its IUPAC name is 2-[4-[[5-[[(1S)-1-(2-cyanophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[[(1S)-1-(2-cyanophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71109475 |
| Molecular Formula | C34H29N3O3 |
| Molecular Weight | 527.62 g/mol |
| Exact Mass | 527.22 |
| IUPAC Name | 2-[4-[[5-[[(1S)-1-(2-cyanophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(C(=O)N[C@@H](C)c3ccccc3C#N)cc12 |
| InChI | InChI=1S/C34H29N3O3/c1-21-23(3)37(20-24-12-14-25(15-13-24)29-10-6-7-11-30(29)34(39)40)32-17-16-26(18-31(21)32)33(38)36-22(2)28-9-5-4-8-27(28)19-35/h4-18,22H,20H2,1-3H3,(H,36,38)(H,39,40)/t22-/m0/s1 |
| InChIKey | QNONMHIFJQGHMT-QFIPXVFZSA-N |
| XLogP | 7.03 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.62 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|