C36H35N3O — CID 71075015
1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-propan-2-ylphenyl)ethyl]indole-5-carboxamide (PubChem CID 71075015) has the molecular formula C36H35N3O and a molecular weight of 525.70 g/mol. Its IUPAC name is 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-propan-2-ylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71075015 |
| Molecular Formula | C36H35N3O |
| Molecular Weight | 525.70 g/mol |
| Exact Mass | 525.28 |
| IUPAC Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C#N)cc2)c2ccc(C(=O)NC(C)c3ccc(C(C)C)cc3)cc12 |
| InChI | InChI=1S/C36H35N3O/c1-23(2)28-14-16-29(17-15-28)25(4)38-36(40)31-18-19-35-34(20-31)24(3)26(5)39(35)22-27-10-12-30(13-11-27)33-9-7-6-8-32(33)21-37/h6-20,23,25H,22H2,1-5H3,(H,38,40) |
| InChIKey | LQQMSEHQQFJJAC-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.70 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|