C34H28F3N3O — CID 71075155
1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide (PubChem CID 71075155) has the molecular formula C34H28F3N3O and a molecular weight of 551.61 g/mol. Its IUPAC name is 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide.
| Compound Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71075155 |
| Molecular Formula | C34H28F3N3O |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.22 |
| IUPAC Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C#N)cc2)c2ccc(C(=O)NC(C)c3ccc(C(F)(F)F)cc3)cc12 |
| InChI | InChI=1S/C34H28F3N3O/c1-21-23(3)40(20-24-8-10-26(11-9-24)30-7-5-4-6-28(30)19-38)32-17-14-27(18-31(21)32)33(41)39-22(2)25-12-15-29(16-13-25)34(35,36)37/h4-18,22H,20H2,1-3H3,(H,39,41) |
| InChIKey | AAOSGWOPAVRNPL-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|