C34H31F3N2O — CID 78012061
2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide (PubChem CID 78012061) has the molecular formula C34H31F3N2O and a molecular weight of 540.63 g/mol. Its IUPAC name is 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 78012061 |
| Molecular Formula | C34H31F3N2O |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.24 |
| IUPAC Name | 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[1-[4-(trifluoromethyl)phenyl]ethyl]indole-5-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(=O)NC(C)c4ccc(C(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C34H31F3N2O/c1-21-7-5-6-8-30(21)27-11-9-25(10-12-27)20-39-24(4)22(2)31-19-28(15-18-32(31)39)33(40)38-23(3)26-13-16-29(17-14-26)34(35,36)37/h5-19,23H,20H2,1-4H3,(H,38,40) |
| InChIKey | KNEQHEWRCQVVSW-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|