C33H29F3N2O — CID 144948501
2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide (PubChem CID 144948501) has the molecular formula C33H29F3N2O and a molecular weight of 526.60 g/mol. Its IUPAC name is 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 144948501 |
| Molecular Formula | C33H29F3N2O |
| Molecular Weight | 526.60 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | 2,3-dimethyl-1-[[4-(2-methylphenyl)phenyl]methyl]-N-[[4-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(=O)NCc4ccc(C(F)(F)F)cc4)ccc32)cc1 |
| InChI | InChI=1S/C33H29F3N2O/c1-21-6-4-5-7-29(21)26-12-8-25(9-13-26)20-38-23(3)22(2)30-18-27(14-17-31(30)38)32(39)37-19-24-10-15-28(16-11-24)33(34,35)36/h4-18H,19-20H2,1-3H3,(H,37,39) |
| InChIKey | FQXLJAZWDNAYNS-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.60 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|