C32H28N2O4 — CID 171467852
[2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl] formate (PubChem CID 171467852) has the molecular formula C32H28N2O4 and a molecular weight of 504.59 g/mol. Its IUPAC name is [2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl] formate.
| Compound Name | [2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl] formate |
|---|---|
| PubChem CID | 171467852 |
| Molecular Formula | C32H28N2O4 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | [2-[4-[[5-[(3-hydroxyphenyl)methylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl] formate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3OC=O)cc2)c2ccc(C(=O)NCc3cccc(O)c3)cc12 |
| InChI | InChI=1S/C32H28N2O4/c1-21-22(2)34(19-23-10-12-25(13-11-23)28-8-3-4-9-31(28)38-20-35)30-15-14-26(17-29(21)30)32(37)33-18-24-6-5-7-27(36)16-24/h3-17,20,36H,18-19H2,1-2H3,(H,33,37) |
| InChIKey | RRDMCJWOBIMQRU-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|