C34H33N2O3P — CID 144948719
N-[(4-methoxy-2-methylphenyl)methyl]-2,3-dimethyl-1-[[4-(2-phosphanylcarbonylphenyl)phenyl]methyl]indole-5-carboxamide (PubChem CID 144948719) has the molecular formula C34H33N2O3P and a molecular weight of 548.62 g/mol. Its IUPAC name is N-[(4-methoxy-2-methylphenyl)methyl]-2,3-dimethyl-1-[[4-(2-phosphanylcarbonylphenyl)phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(4-methoxy-2-methylphenyl)methyl]-2,3-dimethyl-1-[[4-(2-phosphanylcarbonylphenyl)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 144948719 |
| Molecular Formula | C34H33N2O3P |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-[(4-methoxy-2-methylphenyl)methyl]-2,3-dimethyl-1-[[4-(2-phosphanylcarbonylphenyl)phenyl]methyl]indole-5-carboxamide |
| SMILES | COc1ccc(CNC(=O)c2ccc3c(c2)c(C)c(C)n3Cc2ccc(-c3ccccc3C(=O)P)cc2)c(C)c1 |
| InChI | InChI=1S/C34H33N2O3P/c1-21-17-28(39-4)15-13-27(21)19-35-33(37)26-14-16-32-31(18-26)22(2)23(3)36(32)20-24-9-11-25(12-10-24)29-7-5-6-8-30(29)34(38)40/h5-18H,19-20,40H2,1-4H3,(H,35,37) |
| InChIKey | IBDIDWZSIZUSRQ-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|