C37H36N2O4 — CID 71099414
tert-butyl 2-[4-[[2,3-dimethyl-5-(phenacylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate (PubChem CID 71099414) has the molecular formula C37H36N2O4 and a molecular weight of 572.71 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2,3-dimethyl-5-(phenacylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2,3-dimethyl-5-(phenacylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71099414 |
| Molecular Formula | C37H36N2O4 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.27 |
| IUPAC Name | tert-butyl 2-[4-[[2,3-dimethyl-5-(phenacylcarbamoyl)indol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c2ccc(C(=O)NCC(=O)c3ccccc3)cc12 |
| InChI | InChI=1S/C37H36N2O4/c1-24-25(2)39(33-20-19-29(21-32(24)33)35(41)38-22-34(40)28-11-7-6-8-12-28)23-26-15-17-27(18-16-26)30-13-9-10-14-31(30)36(42)43-37(3,4)5/h6-21H,22-23H2,1-5H3,(H,38,41) |
| InChIKey | NVANOIVLCZTEJI-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|