C39H41N3O3 — CID 71074863
tert-butyl 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate (PubChem CID 71074863) has the molecular formula C39H41N3O3 and a molecular weight of 599.78 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71074863 |
| Molecular Formula | C39H41N3O3 |
| Molecular Weight | 599.78 g/mol |
| Exact Mass | 599.31 |
| IUPAC Name | tert-butyl 2-[4-[[5-[1-(6-cyclopropyl-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c2ccc(C(=O)NC(C)c3cccc(C4CC4)n3)cc12 |
| InChI | InChI=1S/C39H41N3O3/c1-24-26(3)42(23-27-14-16-28(17-15-27)31-10-7-8-11-32(31)38(44)45-39(4,5)6)36-21-20-30(22-33(24)36)37(43)40-25(2)34-12-9-13-35(41-34)29-18-19-29/h7-17,20-22,25,29H,18-19,23H2,1-6H3,(H,40,43) |
| InChIKey | LVCOWKIYGWIIOH-UHFFFAOYSA-N |
| XLogP | 8.69 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.78 |
| LogP ≤ 5 | 8.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|