C36H43N3O3 — CID 71090112
tert-butyl 2-[4-[[2,3-dimethyl-5-[[(1R)-1-piperidin-4-ylethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate (PubChem CID 71090112) has the molecular formula C36H43N3O3 and a molecular weight of 565.76 g/mol. Its IUPAC name is tert-butyl 2-[4-[[2,3-dimethyl-5-[[(1R)-1-piperidin-4-ylethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[2,3-dimethyl-5-[[(1R)-1-piperidin-4-ylethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71090112 |
| Molecular Formula | C36H43N3O3 |
| Molecular Weight | 565.76 g/mol |
| Exact Mass | 565.33 |
| IUPAC Name | tert-butyl 2-[4-[[2,3-dimethyl-5-[[(1R)-1-piperidin-4-ylethyl]carbamoyl]indol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c2ccc(C(=O)N[C@H](C)C3CCNCC3)cc12 |
| InChI | InChI=1S/C36H43N3O3/c1-23-25(3)39(33-16-15-29(21-32(23)33)34(40)38-24(2)27-17-19-37-20-18-27)22-26-11-13-28(14-12-26)30-9-7-8-10-31(30)35(41)42-36(4,5)6/h7-16,21,24,27,37H,17-20,22H2,1-6H3,(H,38,40)/t24-/m1/s1 |
| InChIKey | NDSLEQIVCIWRNZ-XMMPIXPASA-N |
| XLogP | 7.05 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.76 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|